C24H49ClN2O2 — CID 67704025
N-butyl-6-cyclohexyl-4-hydroxy-5-(pentylamino)-2-propan-2-ylhexanamide;hydrochloride (PubChem CID 67704025) has the molecular formula C24H49ClN2O2 and a molecular weight of 433.12 g/mol. Its IUPAC name is N-butyl-6-cyclohexyl-4-hydroxy-5-(pentylamino)-2-propan-2-ylhexanamide;hydrochloride.
| Compound Name | N-butyl-6-cyclohexyl-4-hydroxy-5-(pentylamino)-2-propan-2-ylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 67704025 |
| Molecular Formula | C24H49ClN2O2 |
| Molecular Weight | 433.12 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | N-butyl-6-cyclohexyl-4-hydroxy-5-(pentylamino)-2-propan-2-ylhexanamide;hydrochloride |
| SMILES | CCCCCNC(CC1CCCCC1)C(O)CC(C(=O)NCCCC)C(C)C.Cl |
| InChI | InChI=1S/C24H48N2O2.ClH/c1-5-7-12-16-25-22(17-20-13-10-9-11-14-20)23(27)18-21(19(3)4)24(28)26-15-8-6-2;/h19-23,25,27H,5-18H2,1-4H3,(H,26,28);1H |
| InChIKey | KJJUMSKPOORDAB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.12 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|