C21H35N3O6S — CID 57187356
N-[(2S,3S,4S)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 57187356) has the molecular formula C21H35N3O6S and a molecular weight of 457.59 g/mol. Its IUPAC name is N-[(2S,3S,4S)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(2S,3S,4S)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57187356 |
| Molecular Formula | C21H35N3O6S |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[(2S,3S,4S)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCCCNS(=O)(=O)C[C@@H](O)[C@@H](O)[C@H](CC1CCCCC1)NC(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C21H35N3O6S/c1-2-3-11-23-31(29,30)14-18(25)20(27)17(12-15-7-5-4-6-8-15)24-21(28)16-9-10-19(26)22-13-16/h9-10,13,15,17-18,20,23,25,27H,2-8,11-12,14H2,1H3,(H,22,26)(H,24,28)/t17-,18+,20-/m0/s1 |
| InChIKey | DKWPTHDPOZWMGM-NSHGMRRFSA-N |
| XLogP | 0.88 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|