C15H32N2O4S — CID 54512345
(1R,2R,4S)-4-amino-N-butyl-5-cyclohexyl-1,2-dihydroxypentane-1-sulfonamide (PubChem CID 54512345) has the molecular formula C15H32N2O4S and a molecular weight of 336.50 g/mol. Its IUPAC name is (1R,2R,4S)-4-amino-N-butyl-5-cyclohexyl-1,2-dihydroxypentane-1-sulfonamide.
| Compound Name | (1R,2R,4S)-4-amino-N-butyl-5-cyclohexyl-1,2-dihydroxypentane-1-sulfonamide |
|---|---|
| PubChem CID | 54512345 |
| Molecular Formula | C15H32N2O4S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (1R,2R,4S)-4-amino-N-butyl-5-cyclohexyl-1,2-dihydroxypentane-1-sulfonamide |
| SMILES | CCCCNS(=O)(=O)[C@@H](O)[C@H](O)C[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C15H32N2O4S/c1-2-3-9-17-22(20,21)15(19)14(18)11-13(16)10-12-7-5-4-6-8-12/h12-15,17-19H,2-11,16H2,1H3/t13-,14+,15+/m0/s1 |
| InChIKey | YKAAEKYRIWEOAV-RRFJBIMHSA-N |
| XLogP | 1.07 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|