C16H32N2O2S — CID 88638536
N-[(3S,4S)-4-amino-5-cyclohexyl-3-hydroxypentyl]-2-sulfanylpentanamide (PubChem CID 88638536) has the molecular formula C16H32N2O2S and a molecular weight of 316.51 g/mol. Its IUPAC name is N-[(3S,4S)-4-amino-5-cyclohexyl-3-hydroxypentyl]-2-sulfanylpentanamide.
| Compound Name | N-[(3S,4S)-4-amino-5-cyclohexyl-3-hydroxypentyl]-2-sulfanylpentanamide |
|---|---|
| PubChem CID | 88638536 |
| Molecular Formula | C16H32N2O2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N-[(3S,4S)-4-amino-5-cyclohexyl-3-hydroxypentyl]-2-sulfanylpentanamide |
| SMILES | CCCC(S)C(=O)NCC[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C16H32N2O2S/c1-2-6-15(21)16(20)18-10-9-14(19)13(17)11-12-7-4-3-5-8-12/h12-15,19,21H,2-11,17H2,1H3,(H,18,20)/t13-,14-,15?/m0/s1 |
| InChIKey | JWQRCTJOKYEUAX-ZYOSVBKOSA-N |
| XLogP | 2.25 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|