C14H29NO2 — CID 10681709
(2S,3S,5R)-2-amino-1-cyclohexyl-6-methylheptane-3,5-diol (PubChem CID 10681709) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is (2S,3S,5R)-2-amino-1-cyclohexyl-6-methylheptane-3,5-diol.
| Compound Name | (2S,3S,5R)-2-amino-1-cyclohexyl-6-methylheptane-3,5-diol |
|---|---|
| PubChem CID | 10681709 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | (2S,3S,5R)-2-amino-1-cyclohexyl-6-methylheptane-3,5-diol |
| SMILES | CC(C)[C@H](O)C[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C14H29NO2/c1-10(2)13(16)9-14(17)12(15)8-11-6-4-3-5-7-11/h10-14,16-17H,3-9,15H2,1-2H3/t12-,13+,14-/m0/s1 |
| InChIKey | HEVRCWFIVKWFKZ-MJBXVCDLSA-N |
| XLogP | 2.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |