C17H34N2O — CID 10636664
(2S,4R)-2,4-diamino-1,5-dicyclohexylpentan-3-ol (PubChem CID 10636664) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is (2S,4R)-2,4-diamino-1,5-dicyclohexylpentan-3-ol.
| Compound Name | (2S,4R)-2,4-diamino-1,5-dicyclohexylpentan-3-ol |
|---|---|
| PubChem CID | 10636664 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | (2S,4R)-2,4-diamino-1,5-dicyclohexylpentan-3-ol |
| SMILES | N[C@H](CC1CCCCC1)C(O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C17H34N2O/c18-15(11-13-7-3-1-4-8-13)17(20)16(19)12-14-9-5-2-6-10-14/h13-17,20H,1-12,18-19H2/t15-,16+,17? |
| InChIKey | UBLKIGIGKXWPQJ-SJPCQFCGSA-N |
| XLogP | 2.94 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |