C12H25NO4 — CID 54442310
(4R,5S)-5-amino-6-cyclohexylhexane-1,2,3,4-tetrol (PubChem CID 54442310) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is (4R,5S)-5-amino-6-cyclohexylhexane-1,2,3,4-tetrol.
| Compound Name | (4R,5S)-5-amino-6-cyclohexylhexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 54442310 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (4R,5S)-5-amino-6-cyclohexylhexane-1,2,3,4-tetrol |
| SMILES | N[C@@H](CC1CCCCC1)[C@@H](O)C(O)C(O)CO |
| InChI | InChI=1S/C12H25NO4/c13-9(6-8-4-2-1-3-5-8)11(16)12(17)10(15)7-14/h8-12,14-17H,1-7,13H2/t9-,10?,11+,12?/m0/s1 |
| InChIKey | WOZMBJKNSYDXEK-UZEXVOJHSA-N |
| XLogP | -0.64 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |