C11H23NO3 — CID 57086179
(3R,4S)-4-amino-5-cyclohexylpentane-1,2,3-triol (PubChem CID 57086179) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is (3R,4S)-4-amino-5-cyclohexylpentane-1,2,3-triol.
| Compound Name | (3R,4S)-4-amino-5-cyclohexylpentane-1,2,3-triol |
|---|---|
| PubChem CID | 57086179 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | (3R,4S)-4-amino-5-cyclohexylpentane-1,2,3-triol |
| SMILES | N[C@@H](CC1CCCCC1)[C@@H](O)C(O)CO |
| InChI | InChI=1S/C11H23NO3/c12-9(11(15)10(14)7-13)6-8-4-2-1-3-5-8/h8-11,13-15H,1-7,12H2/t9-,10?,11+/m0/s1 |
| InChIKey | ZXPPFUVEFWFPPZ-KHUXNXPUSA-N |
| XLogP | -0.00 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |