C14H31Cl2NO2 — CID 18643833
(2S,3R,4S)-2-amino-1-cyclohexyl-6-methylheptane-3,4-diol;dihydrochloride (PubChem CID 18643833) has the molecular formula C14H31Cl2NO2 and a molecular weight of 316.31 g/mol. Its IUPAC name is (2S,3R,4S)-2-amino-1-cyclohexyl-6-methylheptane-3,4-diol;dihydrochloride.
| Compound Name | (2S,3R,4S)-2-amino-1-cyclohexyl-6-methylheptane-3,4-diol;dihydrochloride |
|---|---|
| PubChem CID | 18643833 |
| Molecular Formula | C14H31Cl2NO2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (2S,3R,4S)-2-amino-1-cyclohexyl-6-methylheptane-3,4-diol;dihydrochloride |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@@H](N)CC1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C14H29NO2.2ClH/c1-10(2)8-13(16)14(17)12(15)9-11-6-4-3-5-7-11;;/h10-14,16-17H,3-9,15H2,1-2H3;2*1H/t12-,13-,14+;;/m0../s1 |
| InChIKey | RZTJUTCYSGNQSD-HTTVLNLHSA-N |
| XLogP | 2.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |