C11H22N4O2 — CID 58964071
(2S,3R)-4-amino-1-azido-5-cyclohexylpentane-2,3-diol (PubChem CID 58964071) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (2S,3R)-4-amino-1-azido-5-cyclohexylpentane-2,3-diol.
| Compound Name | (2S,3R)-4-amino-1-azido-5-cyclohexylpentane-2,3-diol |
|---|---|
| PubChem CID | 58964071 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (2S,3R)-4-amino-1-azido-5-cyclohexylpentane-2,3-diol |
| SMILES | [N-]=[N+]=NC[C@H](O)[C@H](O)C(N)CC1CCCCC1 |
| InChI | InChI=1S/C11H22N4O2/c12-9(6-8-4-2-1-3-5-8)11(17)10(16)7-14-15-13/h8-11,16-17H,1-7,12H2/t9?,10-,11+/m0/s1 |
| InChIKey | FKWRQIUBLRZGDO-QXXIUIOUSA-N |
| XLogP | 1.32 |
| TPSA | 115.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|