C14H29NO3 — CID 22154938
2-amino-1-cyclohexyl-6-methylheptane-3,4,5-triol (PubChem CID 22154938) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-amino-1-cyclohexyl-6-methylheptane-3,4,5-triol.
| Compound Name | 2-amino-1-cyclohexyl-6-methylheptane-3,4,5-triol |
|---|---|
| PubChem CID | 22154938 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 2-amino-1-cyclohexyl-6-methylheptane-3,4,5-triol |
| SMILES | CC(C)C(O)C(O)C(O)C(N)CC1CCCCC1 |
| InChI | InChI=1S/C14H29NO3/c1-9(2)12(16)14(18)13(17)11(15)8-10-6-4-3-5-7-10/h9-14,16-18H,3-8,15H2,1-2H3 |
| InChIKey | KWMMVQBSXOYKIG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |