C14H28F2N2O — CID 18655656
(2S,3R,5S)-2,5-diamino-1-cyclohexyl-4,4-difluoro-6-methylheptan-3-ol (PubChem CID 18655656) has the molecular formula C14H28F2N2O and a molecular weight of 278.39 g/mol. Its IUPAC name is (2S,3R,5S)-2,5-diamino-1-cyclohexyl-4,4-difluoro-6-methylheptan-3-ol.
| Compound Name | (2S,3R,5S)-2,5-diamino-1-cyclohexyl-4,4-difluoro-6-methylheptan-3-ol |
|---|---|
| PubChem CID | 18655656 |
| Molecular Formula | C14H28F2N2O |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (2S,3R,5S)-2,5-diamino-1-cyclohexyl-4,4-difluoro-6-methylheptan-3-ol |
| SMILES | CC(C)[C@H](N)C(F)(F)[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C14H28F2N2O/c1-9(2)12(18)14(15,16)13(19)11(17)8-10-6-4-3-5-7-10/h9-13,19H,3-8,17-18H2,1-2H3/t11-,12-,13+/m0/s1 |
| InChIKey | MIEJXDMTZCTOME-RWMBFGLXSA-N |
| XLogP | 2.26 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |