C13H25BrO2 — CID 10827545
(2R,3S,4R)-2-bromo-1-cyclohexyl-5-methylhexane-3,4-diol (PubChem CID 10827545) has the molecular formula C13H25BrO2 and a molecular weight of 293.24 g/mol. Its IUPAC name is (2R,3S,4R)-2-bromo-1-cyclohexyl-5-methylhexane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-bromo-1-cyclohexyl-5-methylhexane-3,4-diol |
|---|---|
| PubChem CID | 10827545 |
| Molecular Formula | C13H25BrO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (2R,3S,4R)-2-bromo-1-cyclohexyl-5-methylhexane-3,4-diol |
| SMILES | CC(C)[C@@H](O)[C@H](O)[C@H](Br)CC1CCCCC1 |
| InChI | InChI=1S/C13H25BrO2/c1-9(2)12(15)13(16)11(14)8-10-6-4-3-5-7-10/h9-13,15-16H,3-8H2,1-2H3/t11-,12-,13-/m1/s1 |
| InChIKey | OCNSQCNFFSYEHH-JHJVBQTASA-N |
| XLogP | 3.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|