C16H32 — CID 123220792
2,3-dimethylbutylcyclodecane (PubChem CID 123220792) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is 2,3-dimethylbutylcyclodecane.
| Compound Name | 2,3-dimethylbutylcyclodecane |
|---|---|
| PubChem CID | 123220792 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | 2,3-dimethylbutylcyclodecane |
| SMILES | CC(C)C(C)CC1CCCCCCCCC1 |
| InChI | InChI=1S/C16H32/c1-14(2)15(3)13-16-11-9-7-5-4-6-8-10-12-16/h14-16H,4-13H2,1-3H3 |
| InChIKey | MBVRLEKBTHZIIS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |