C10H20O2 — CID 20647941
3-cyclohexyl-2-methylpropane-1,1-diol (PubChem CID 20647941) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-cyclohexyl-2-methylpropane-1,1-diol.
| Compound Name | 3-cyclohexyl-2-methylpropane-1,1-diol |
|---|---|
| PubChem CID | 20647941 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 3-cyclohexyl-2-methylpropane-1,1-diol |
| SMILES | CC(CC1CCCCC1)C(O)O |
| InChI | InChI=1S/C10H20O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h8-12H,2-7H2,1H3 |
| InChIKey | AWTQVQXBYOEWHR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|