C26H52 — CID 159692112
2-methylpropylcyclohexane;2-methylpropylcyclopentane;2-methylpropylcyclopropane (PubChem CID 159692112) has the molecular formula C26H52 and a molecular weight of 364.70 g/mol. Its IUPAC name is 2-methylpropylcyclohexane;2-methylpropylcyclopentane;2-methylpropylcyclopropane.
| Compound Name | 2-methylpropylcyclohexane;2-methylpropylcyclopentane;2-methylpropylcyclopropane |
|---|---|
| PubChem CID | 159692112 |
| Molecular Formula | C26H52 |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.41 |
| IUPAC Name | 2-methylpropylcyclohexane;2-methylpropylcyclopentane;2-methylpropylcyclopropane |
| SMILES | CC(C)CC1CC1.CC(C)CC1CCCC1.CC(C)CC1CCCCC1 |
| InChI | InChI=1S/C10H20.C9H18.C7H14/c1-9(2)8-10-6-4-3-5-7-10;1-8(2)7-9-5-3-4-6-9;1-6(2)5-7-3-4-7/h9-10H,3-8H2,1-2H3;8-9H,3-7H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | MWNWVXLJTBJENT-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |