C16H32 — CID 159402972
2-methylpropylcyclopentane;2-methylpropylcyclopropane (PubChem CID 159402972) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is 2-methylpropylcyclopentane;2-methylpropylcyclopropane.
| Compound Name | 2-methylpropylcyclopentane;2-methylpropylcyclopropane |
|---|---|
| PubChem CID | 159402972 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | 2-methylpropylcyclopentane;2-methylpropylcyclopropane |
| SMILES | CC(C)CC1CC1.CC(C)CC1CCCC1 |
| InChI | InChI=1S/C9H18.C7H14/c1-8(2)7-9-5-3-4-6-9;1-6(2)5-7-3-4-7/h8-9H,3-7H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | LNOXFGXNQJABCC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |