C37H74 — CID 161332116
3-methylbutan-2-ylcyclohexane;bis(2-methylpropylcyclobutane);2-methylpropylcyclohexane (PubChem CID 161332116) has the molecular formula C37H74 and a molecular weight of 519.00 g/mol. Its IUPAC name is 3-methylbutan-2-ylcyclohexane;bis(2-methylpropylcyclobutane);2-methylpropylcyclohexane.
| Compound Name | 3-methylbutan-2-ylcyclohexane;bis(2-methylpropylcyclobutane);2-methylpropylcyclohexane |
|---|---|
| PubChem CID | 161332116 |
| Molecular Formula | C37H74 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.58 |
| IUPAC Name | 3-methylbutan-2-ylcyclohexane;bis(2-methylpropylcyclobutane);2-methylpropylcyclohexane |
| SMILES | CC(C)C(C)C1CCCCC1.CC(C)CC1CCC1.CC(C)CC1CCC1.CC(C)CC1CCCCC1 |
| InChI | InChI=1S/C11H22.C10H20.2C8H16/c1-9(2)10(3)11-7-5-4-6-8-11;1-9(2)8-10-6-4-3-5-7-10;2*1-7(2)6-8-4-3-5-8/h9-11H,4-8H2,1-3H3;9-10H,3-8H2,1-2H3;2*7-8H,3-6H2,1-2H3 |
| InChIKey | VLOCWPKGTXTBIO-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |