C10H22 — CID 161254337
methane;2-methylpropylcyclopentane (PubChem CID 161254337) has the molecular formula C10H22 and a molecular weight of 142.29 g/mol. Its IUPAC name is methane;2-methylpropylcyclopentane.
| Compound Name | methane;2-methylpropylcyclopentane |
|---|---|
| PubChem CID | 161254337 |
| Molecular Formula | C10H22 |
| Molecular Weight | 142.29 g/mol |
| Exact Mass | 142.17 |
| IUPAC Name | methane;2-methylpropylcyclopentane |
| SMILES | C.CC(C)CC1CCCC1 |
| InChI | InChI=1S/C9H18.CH4/c1-8(2)7-9-5-3-4-6-9;/h8-9H,3-7H2,1-2H3;1H4 |
| InChIKey | VBRUGQWIVWDUTE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |