About 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane
2-methylpropylcyclobutane;4-(2-methylpropyl)oxane (PubChem CID 157070530) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane.
Molecular Properties
| Compound Name | 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane |
| PubChem CID | 157070530 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane |
| SMILES | CC(C)CC1CCC1.CC(C)CC1CCOCC1 |
| InChI | InChI=1S/C9H18O.C8H16/c1-8(2)7-9-3-5-10-6-4-9;1-7(2)6-8-4-3-5-8/h8-9H,3-7H2,1-2H3;7-8H,3-6H2,1-2H3 |
| InChIKey | ACJKCXUNIMCGPZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane?
The IUPAC name of 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane (CID 157070530) is 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane.
What is the SMILES notation for 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane?
The canonical SMILES for 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane is CC(C)CC1CCC1.CC(C)CC1CCOCC1.
What is the InChIKey of 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane?
The InChIKey is ACJKCXUNIMCGPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C8H16/c1-8(2)7-9-3-5-10-6-4-9;1-7(2)6-8-4-3-5-8/h8-9H,3-7H2,1-2H3;7-8H,3-6H2,1-2H3.
What are the key properties of 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane?
2-methylpropylcyclobutane;4-(2-methylpropyl)oxane has a molecular weight of 254.46 g/mol, XLogP of 5.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylcyclobutane;4-(2-methylpropyl)oxane is sourced from PubChem (CID 157070530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).