About cyclopentane;iron;2-methylpropylcyclopentane
cyclopentane;iron;2-methylpropylcyclopentane (PubChem CID 172726896) has the molecular formula C14H28Fe
and a molecular weight of 252.22 g/mol. Its IUPAC name is cyclopentane;iron;2-methylpropylcyclopentane.
Molecular Properties
| Compound Name | cyclopentane;iron;2-methylpropylcyclopentane |
| PubChem CID | 172726896 |
| Molecular Formula | C14H28Fe |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | cyclopentane;iron;2-methylpropylcyclopentane |
| SMILES | C1CCCC1.CC(C)CC1CCCC1.[Fe] |
| InChI | InChI=1S/C9H18.C5H10.Fe/c1-8(2)7-9-5-3-4-6-9;1-2-4-5-3-1;/h8-9H,3-7H2,1-2H3;1-5H2; |
| InChIKey | ONXRVLIFEWBUMW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;iron;2-methylpropylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;iron;2-methylpropylcyclopentane?
The IUPAC name of cyclopentane;iron;2-methylpropylcyclopentane (CID 172726896) is cyclopentane;iron;2-methylpropylcyclopentane.
What is the SMILES notation for cyclopentane;iron;2-methylpropylcyclopentane?
The canonical SMILES for cyclopentane;iron;2-methylpropylcyclopentane is C1CCCC1.CC(C)CC1CCCC1.[Fe].
What is the InChIKey of cyclopentane;iron;2-methylpropylcyclopentane?
The InChIKey is ONXRVLIFEWBUMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C5H10.Fe/c1-8(2)7-9-5-3-4-6-9;1-2-4-5-3-1;/h8-9H,3-7H2,1-2H3;1-5H2;.
What are the key properties of cyclopentane;iron;2-methylpropylcyclopentane?
cyclopentane;iron;2-methylpropylcyclopentane has a molecular weight of 252.22 g/mol, XLogP of 5.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;iron;2-methylpropylcyclopentane is sourced from PubChem (CID 172726896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).