C12H24O4 — CID 54540635
(2R,3R,4R)-6-cyclohexylhexane-1,2,3,4-tetrol (PubChem CID 54540635) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is (2R,3R,4R)-6-cyclohexylhexane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4R)-6-cyclohexylhexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 54540635 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (2R,3R,4R)-6-cyclohexylhexane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)CCC1CCCCC1 |
| InChI | InChI=1S/C12H24O4/c13-8-11(15)12(16)10(14)7-6-9-4-2-1-3-5-9/h9-16H,1-8H2/t10-,11-,12-/m1/s1 |
| InChIKey | ZCXYYPOVXLESMV-IJLUTSLNSA-N |
| XLogP | 0.42 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |