C13H27NO4 — CID 127036001
(2R,3R,4R)-5-(cyclooctylamino)pentane-1,2,3,4-tetrol (PubChem CID 127036001) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is (2R,3R,4R)-5-(cyclooctylamino)pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4R)-5-(cyclooctylamino)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 127036001 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (2R,3R,4R)-5-(cyclooctylamino)pentane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)CNC1CCCCCCC1 |
| InChI | InChI=1S/C13H27NO4/c15-9-12(17)13(18)11(16)8-14-10-6-4-2-1-3-5-7-10/h10-18H,1-9H2/t11-,12-,13-/m1/s1 |
| InChIKey | HSNCSKOVCRVSQI-JHJVBQTASA-N |
| XLogP | -0.24 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |