C12H23NO6 — CID 11482797
(2R,3S,4R,5R)-N-cyclohexyl-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 11482797) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is (2R,3S,4R,5R)-N-cyclohexyl-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2R,3S,4R,5R)-N-cyclohexyl-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 11482797 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (2R,3S,4R,5R)-N-cyclohexyl-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | O=C(NC1CCCCC1)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H23NO6/c14-6-8(15)9(16)10(17)11(18)12(19)13-7-4-2-1-3-5-7/h7-11,14-18H,1-6H2,(H,13,19)/t8-,9-,10+,11-/m1/s1 |
| InChIKey | VQCGPMVENPEPDO-CHWFTXMASA-N |
| XLogP | -2.13 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |