C18H33NO6 — CID 98565543
(2R,3R,4R,5R)-N,N-dicyclohexyl-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 98565543) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is (2R,3R,4R,5R)-N,N-dicyclohexyl-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2R,3R,4R,5R)-N,N-dicyclohexyl-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 98565543 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (2R,3R,4R,5R)-N,N-dicyclohexyl-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | O=C([C@H](O)[C@H](O)[C@H](O)[C@H](O)CO)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H33NO6/c20-11-14(21)15(22)16(23)17(24)18(25)19(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h12-17,20-24H,1-11H2/t14-,15-,16-,17-/m1/s1 |
| InChIKey | PSXGIKUTSBJBOU-QBPKDAKJSA-N |
| XLogP | -0.08 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |