C8H16N2O7 — CID 174309225
(2R,3S,4R,5R)-N-carbamoyl-2,3,4,5,6-pentahydroxy-N-methylhexanamide (PubChem CID 174309225) has the molecular formula C8H16N2O7 and a molecular weight of 252.22 g/mol. Its IUPAC name is (2R,3S,4R,5R)-N-carbamoyl-2,3,4,5,6-pentahydroxy-N-methylhexanamide.
| Compound Name | (2R,3S,4R,5R)-N-carbamoyl-2,3,4,5,6-pentahydroxy-N-methylhexanamide |
|---|---|
| PubChem CID | 174309225 |
| Molecular Formula | C8H16N2O7 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (2R,3S,4R,5R)-N-carbamoyl-2,3,4,5,6-pentahydroxy-N-methylhexanamide |
| SMILES | CN(C(N)=O)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16N2O7/c1-10(8(9)17)7(16)6(15)5(14)4(13)3(12)2-11/h3-6,11-15H,2H2,1H3,(H2,9,17)/t3-,4-,5+,6-/m1/s1 |
| InChIKey | INHZBWFRFHFSOV-ARQDHWQXSA-N |
| XLogP | -4.04 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |