C12H27NO12 — CID 87972607
(2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 87972607) has the molecular formula C12H27NO12 and a molecular weight of 377.34 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 87972607 |
| Molecular Formula | C12H27NO12 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H15NO5.C6H12O7/c7-1-3(9)5(11)6(12)4(10)2-8;7-1-2(8)3(9)4(10)5(11)6(12)13/h3-6,8-12H,1-2,7H2;2-5,7-11H,1H2,(H,12,13)/t3-,4+,5+,6+;2-,3+,4-,5-/m01/s1 |
| InChIKey | ZMLKKEXQKLYFMP-OWXMODPSSA-N |
| XLogP | -7.11 |
| TPSA | 265.62 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | -7.11 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |