C8H15NO7 — CID 174506836
1-amino-4,5,6,7,8-pentahydroxyoctane-2,3-dione (PubChem CID 174506836) has the molecular formula C8H15NO7 and a molecular weight of 237.21 g/mol. Its IUPAC name is 1-amino-4,5,6,7,8-pentahydroxyoctane-2,3-dione.
| Compound Name | 1-amino-4,5,6,7,8-pentahydroxyoctane-2,3-dione |
|---|---|
| PubChem CID | 174506836 |
| Molecular Formula | C8H15NO7 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-amino-4,5,6,7,8-pentahydroxyoctane-2,3-dione |
| SMILES | NCC(=O)C(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H15NO7/c9-1-3(11)5(13)7(15)8(16)6(14)4(12)2-10/h4,6-8,10,12,14-16H,1-2,9H2 |
| InChIKey | KURKJCPMFRCBEN-UHFFFAOYSA-N |
| XLogP | -4.48 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|