C8H15MgNO9 — CID 143308696
magnesium;2-aminoacetate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 143308696) has the molecular formula C8H15MgNO9 and a molecular weight of 293.51 g/mol. Its IUPAC name is magnesium;2-aminoacetate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | magnesium;2-aminoacetate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 143308696 |
| Molecular Formula | C8H15MgNO9 |
| Molecular Weight | 293.51 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | magnesium;2-aminoacetate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | NCC(=O)[O-].O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Mg+2] |
| InChI | InChI=1S/C6H12O7.C2H5NO2.Mg/c7-1-2(8)3(9)4(10)5(11)6(12)13;3-1-2(4)5;/h2-5,7-11H,1H2,(H,12,13);1,3H2,(H,4,5);/q;;+2/p-2/t2-,3-,4+,5-;;/m1../s1 |
| InChIKey | NDYBYPATPFDZGT-ZBHRUSISSA-L |
| XLogP | -7.51 |
| TPSA | 207.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.51 |
| LogP ≤ 5 | -7.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |