C7H11BrO6 — CID 141458854
(4S,5R,6R)-1-bromo-4,5,6,7-tetrahydroxyheptane-2,3-dione (PubChem CID 141458854) has the molecular formula C7H11BrO6 and a molecular weight of 271.06 g/mol. Its IUPAC name is (4S,5R,6R)-1-bromo-4,5,6,7-tetrahydroxyheptane-2,3-dione.
| Compound Name | (4S,5R,6R)-1-bromo-4,5,6,7-tetrahydroxyheptane-2,3-dione |
|---|---|
| PubChem CID | 141458854 |
| Molecular Formula | C7H11BrO6 |
| Molecular Weight | 271.06 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | (4S,5R,6R)-1-bromo-4,5,6,7-tetrahydroxyheptane-2,3-dione |
| SMILES | O=C(CBr)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H11BrO6/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h4,6-7,9,11,13-14H,1-2H2/t4-,6-,7-/m1/s1 |
| InChIKey | MJJVLMPJDUFUPG-QPPQHZFASA-N |
| XLogP | -2.41 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.06 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|