C12H18O13 — CID 90794212
[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoyl] (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoate (PubChem CID 90794212) has the molecular formula C12H18O13 and a molecular weight of 370.26 g/mol. Its IUPAC name is [(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoyl] (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoate.
| Compound Name | [(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoyl] (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoate |
|---|---|
| PubChem CID | 90794212 |
| Molecular Formula | C12H18O13 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | [(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoyl] (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoate |
| SMILES | O=C(OC(=O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H18O13/c13-1-3(15)5(17)7(19)9(21)11(23)25-12(24)10(22)8(20)6(18)4(16)2-14/h3-8,13-20H,1-2H2/t3-,4-,5-,6-,7+,8+/m1/s1 |
| InChIKey | CEXJQCIUKQZDCP-GBFNJJICSA-N |
| XLogP | -6.66 |
| TPSA | 239.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | -6.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|