2,3,4,5-tetrahydroxypentanoic acid

C5H10O6 — CID 10264

IUPAC2,3,4,5-tetrahydroxypentanoic acid
SMILESO=C(O)C(O)C(O)C(O)CO
InChIInChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)
InChIKeyQXKAIJAYHKCRRA-UHFFFAOYSA-N
MW166.13 g/mol
LogP-2.85
Rot. Bonds4

About 2,3,4,5-tetrahydroxypentanoic acid

2,3,4,5-tetrahydroxypentanoic acid (PubChem CID 10264) has the molecular formula C5H10O6 and a molecular weight of 166.13 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxypentanoic acid.

Molecular Properties

Compound Name2,3,4,5-tetrahydroxypentanoic acid
PubChem CID10264
Molecular FormulaC5H10O6
Molecular Weight166.13 g/mol
Exact Mass166.05
IUPAC Name2,3,4,5-tetrahydroxypentanoic acid
SMILESO=C(O)C(O)C(O)C(O)CO
InChIInChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)
InChIKeyQXKAIJAYHKCRRA-UHFFFAOYSA-N
XLogP-2.85
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.13
LogP ≤ 5-2.85
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 2,3,4,5-tetrahydroxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(113C)hexanoic acid
CID 165412478
hexane-1,2,3,4,5,6-hexol;2,3,4,5,6-pentahydroxyhexanoic acid
CID 174726112
(4R)-2,3,4,5,6-pentahydroxyhexanoic acid
CID 134944021
(3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid
CID 11479470
azane;bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid)
CID 175905684
copper;bis((2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoic acid)
CID 14475284
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;(2S,4R)-pentane-1,2,3,4,5-pentol
CID 175899129
2,3,4,5,6-pentahydroxyhexanoic acid;samarium
CID 174356569
pentacosazinc;tridecakis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid)
CID 173246066
(2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid
CID 3084118
copper;pentakis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid)
CID 173123824
bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid);titanium
CID 132993109

Frequently Asked Questions

What is the IUPAC name of 2,3,4,5-tetrahydroxypentanoic acid?
The IUPAC name of 2,3,4,5-tetrahydroxypentanoic acid (CID 10264) is 2,3,4,5-tetrahydroxypentanoic acid.
What is the SMILES notation for 2,3,4,5-tetrahydroxypentanoic acid?
The canonical SMILES for 2,3,4,5-tetrahydroxypentanoic acid is O=C(O)C(O)C(O)C(O)CO.
What is the InChIKey of 2,3,4,5-tetrahydroxypentanoic acid?
The InChIKey is QXKAIJAYHKCRRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11).
What are the key properties of 2,3,4,5-tetrahydroxypentanoic acid?
2,3,4,5-tetrahydroxypentanoic acid has a molecular weight of 166.13 g/mol, XLogP of -2.85, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrahydroxypentanoic acid is sourced from PubChem (CID 10264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).