C8H14O9 — CID 87774501
(3S,4S,5R,6R)-3,4,5,6,7,8-hexahydroxy-2-oxooctanoic acid (PubChem CID 87774501) has the molecular formula C8H14O9 and a molecular weight of 254.19 g/mol. Its IUPAC name is (3S,4S,5R,6R)-3,4,5,6,7,8-hexahydroxy-2-oxooctanoic acid.
| Compound Name | (3S,4S,5R,6R)-3,4,5,6,7,8-hexahydroxy-2-oxooctanoic acid |
|---|---|
| PubChem CID | 87774501 |
| Molecular Formula | C8H14O9 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (3S,4S,5R,6R)-3,4,5,6,7,8-hexahydroxy-2-oxooctanoic acid |
| SMILES | O=C(O)C(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO |
| InChI | InChI=1S/C8H14O9/c9-1-2(10)3(11)4(12)5(13)6(14)7(15)8(16)17/h2-6,9-14H,1H2,(H,16,17)/t2?,3-,4-,5+,6+/m1/s1 |
| InChIKey | DXNVVRCIIJGFIP-AGPGYFGTSA-N |
| XLogP | -4.56 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|