C16H28N2O4 — CID 91261250
(2R,3R)-N',N'-dicyclohexyl-2,3-dihydroxybutanediamide (PubChem CID 91261250) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2R,3R)-N',N'-dicyclohexyl-2,3-dihydroxybutanediamide.
| Compound Name | (2R,3R)-N',N'-dicyclohexyl-2,3-dihydroxybutanediamide |
|---|---|
| PubChem CID | 91261250 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2R,3R)-N',N'-dicyclohexyl-2,3-dihydroxybutanediamide |
| SMILES | NC(=O)[C@H](O)[C@@H](O)C(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H28N2O4/c17-15(21)13(19)14(20)16(22)18(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-14,19-20H,1-10H2,(H2,17,21)/t13-,14-/m1/s1 |
| InChIKey | YISJUUMPIBBTKI-ZIAGYGMSSA-N |
| XLogP | 0.69 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |