C16H28N2O — CID 116653816
1,1-dicyclohexyl-3-cyclopropylurea (PubChem CID 116653816) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-cyclopropylurea.
| Compound Name | 1,1-dicyclohexyl-3-cyclopropylurea |
|---|---|
| PubChem CID | 116653816 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 1,1-dicyclohexyl-3-cyclopropylurea |
| SMILES | O=C(NC1CC1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H28N2O/c19-16(17-13-11-12-13)18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h13-15H,1-12H2,(H,17,19) |
| InChIKey | STYMBBUNZNKTGH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |