C14H26N4O2S — CID 87475337
1-(carbamoylamino)sulfanyl-1,3-dicyclohexylurea (PubChem CID 87475337) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is 1-(carbamoylamino)sulfanyl-1,3-dicyclohexylurea.
| Compound Name | 1-(carbamoylamino)sulfanyl-1,3-dicyclohexylurea |
|---|---|
| PubChem CID | 87475337 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-(carbamoylamino)sulfanyl-1,3-dicyclohexylurea |
| SMILES | NC(=O)NSN(C(=O)NC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H26N4O2S/c15-13(19)17-21-18(12-9-5-2-6-10-12)14(20)16-11-7-3-1-4-8-11/h11-12H,1-10H2,(H,16,20)(H3,15,17,19) |
| InChIKey | SAVDDVJRFMNQBQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|