C11H21N3O2 — CID 103101665
2-[cyclohexylcarbamoyl(ethyl)amino]acetamide (PubChem CID 103101665) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[cyclohexylcarbamoyl(ethyl)amino]acetamide.
| Compound Name | 2-[cyclohexylcarbamoyl(ethyl)amino]acetamide |
|---|---|
| PubChem CID | 103101665 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 2-[cyclohexylcarbamoyl(ethyl)amino]acetamide |
| SMILES | CCN(CC(N)=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H21N3O2/c1-2-14(8-10(12)15)11(16)13-9-6-4-3-5-7-9/h9H,2-8H2,1H3,(H2,12,15)(H,13,16) |
| InChIKey | IIILJQUUCDZQHZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |