C11H23N3O — CID 79160886
3-(azepan-3-yl)-1,1-diethylurea (PubChem CID 79160886) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-(azepan-3-yl)-1,1-diethylurea.
| Compound Name | 3-(azepan-3-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 79160886 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-(azepan-3-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC1CCCCNC1 |
| InChI | InChI=1S/C11H23N3O/c1-3-14(4-2)11(15)13-10-7-5-6-8-12-9-10/h10,12H,3-9H2,1-2H3,(H,13,15) |
| InChIKey | ZXVYQTMBEVYARH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |