About cyclobutylurea;ethane
cyclobutylurea;ethane (PubChem CID 145319429) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is cyclobutylurea;ethane.
Molecular Properties
| Compound Name | cyclobutylurea;ethane |
| PubChem CID | 145319429 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | cyclobutylurea;ethane |
| SMILES | CC.NC(=O)NC1CCC1 |
| InChI | InChI=1S/C5H10N2O.C2H6/c6-5(8)7-4-2-1-3-4;1-2/h4H,1-3H2,(H3,6,7,8);1-2H3 |
| InChIKey | RCKPXRSJPAWOSB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclobutylurea;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylurea;ethane?
The IUPAC name of cyclobutylurea;ethane (CID 145319429) is cyclobutylurea;ethane.
What is the SMILES notation for cyclobutylurea;ethane?
The canonical SMILES for cyclobutylurea;ethane is CC.NC(=O)NC1CCC1.
What is the InChIKey of cyclobutylurea;ethane?
The InChIKey is RCKPXRSJPAWOSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.C2H6/c6-5(8)7-4-2-1-3-4;1-2/h4H,1-3H2,(H3,6,7,8);1-2H3.
What are the key properties of cyclobutylurea;ethane?
cyclobutylurea;ethane has a molecular weight of 144.22 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylurea;ethane is sourced from PubChem (CID 145319429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).