About (4-chlorocyclohexyl)urea
(4-chlorocyclohexyl)urea (PubChem CID 86732946) has the molecular formula C7H13ClN2O
and a molecular weight of 176.65 g/mol. Its IUPAC name is (4-chlorocyclohexyl)urea.
Molecular Properties
| Compound Name | (4-chlorocyclohexyl)urea |
| PubChem CID | 86732946 |
| Molecular Formula | C7H13ClN2O |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | (4-chlorocyclohexyl)urea |
| SMILES | NC(=O)NC1CCC(Cl)CC1 |
| InChI | InChI=1S/C7H13ClN2O/c8-5-1-3-6(4-2-5)10-7(9)11/h5-6H,1-4H2,(H3,9,10,11) |
| InChIKey | YKFYIVHNIDHLBO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorocyclohexyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorocyclohexyl)urea?
The IUPAC name of (4-chlorocyclohexyl)urea (CID 86732946) is (4-chlorocyclohexyl)urea.
What is the SMILES notation for (4-chlorocyclohexyl)urea?
The canonical SMILES for (4-chlorocyclohexyl)urea is NC(=O)NC1CCC(Cl)CC1.
What is the InChIKey of (4-chlorocyclohexyl)urea?
The InChIKey is YKFYIVHNIDHLBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClN2O/c8-5-1-3-6(4-2-5)10-7(9)11/h5-6H,1-4H2,(H3,9,10,11).
What are the key properties of (4-chlorocyclohexyl)urea?
(4-chlorocyclohexyl)urea has a molecular weight of 176.65 g/mol, XLogP of 1.20, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorocyclohexyl)urea is sourced from PubChem (CID 86732946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).