C14H18FN3O2 — CID 47069861
4-(carbamoylamino)-N-(4-fluorophenyl)cyclohexane-1-carboxamide (PubChem CID 47069861) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-(carbamoylamino)-N-(4-fluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(carbamoylamino)-N-(4-fluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 47069861 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-(carbamoylamino)-N-(4-fluorophenyl)cyclohexane-1-carboxamide |
| SMILES | NC(=O)NC1CCC(C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H18FN3O2/c15-10-3-7-11(8-4-10)17-13(19)9-1-5-12(6-2-9)18-14(16)20/h3-4,7-9,12H,1-2,5-6H2,(H,17,19)(H3,16,18,20) |
| InChIKey | LKLIGQULUXDENZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |