C14H18N4O — CID 165403886
N-[4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]phenyl]cyclopropanecarboxamide (PubChem CID 165403886) has the molecular formula C14H18N4O and a molecular weight of 258.33 g/mol. Its IUPAC name is N-[4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 165403886 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]phenyl]cyclopropanecarboxamide |
| SMILES | NC(N)=C/C=C(\N)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C14H18N4O/c15-12(7-8-13(16)17)9-3-5-11(6-4-9)18-14(19)10-1-2-10/h3-8,10H,1-2,15-17H2,(H,18,19)/b12-7- |
| InChIKey | CXMSSCRHPAOUGY-GHXNOFRVSA-N |
| XLogP | 1.09 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|