C15H28N6O3 — CID 163452854
1,3-bis[4-(carbamoylamino)cyclohexyl]urea (PubChem CID 163452854) has the molecular formula C15H28N6O3 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1,3-bis[4-(carbamoylamino)cyclohexyl]urea.
| Compound Name | 1,3-bis[4-(carbamoylamino)cyclohexyl]urea |
|---|---|
| PubChem CID | 163452854 |
| Molecular Formula | C15H28N6O3 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1,3-bis[4-(carbamoylamino)cyclohexyl]urea |
| SMILES | NC(=O)NC1CCC(NC(=O)NC2CCC(NC(N)=O)CC2)CC1 |
| InChI | InChI=1S/C15H28N6O3/c16-13(22)18-9-1-5-11(6-2-9)20-15(24)21-12-7-3-10(4-8-12)19-14(17)23/h9-12H,1-8H2,(H3,16,18,22)(H3,17,19,23)(H2,20,21,24) |
| InChIKey | BHZQATBCSRKFAX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |