C7H14N4O2 — CID 115635300
1-[2-(carbamoylamino)ethyl]-3-cyclopropylurea (PubChem CID 115635300) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-[2-(carbamoylamino)ethyl]-3-cyclopropylurea.
| Compound Name | 1-[2-(carbamoylamino)ethyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 115635300 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 1-[2-(carbamoylamino)ethyl]-3-cyclopropylurea |
| SMILES | NC(=O)NCCNC(=O)NC1CC1 |
| InChI | InChI=1S/C7H14N4O2/c8-6(12)9-3-4-10-7(13)11-5-1-2-5/h5H,1-4H2,(H3,8,9,12)(H2,10,11,13) |
| InChIKey | CLARDJFPHJMIIB-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|