C14H27N5O3 — CID 59418797
N-[2-[[4-(ethylcarbamoylamino)cyclohexyl]carbamoylamino]ethyl]acetamide (PubChem CID 59418797) has the molecular formula C14H27N5O3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[2-[[4-(ethylcarbamoylamino)cyclohexyl]carbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[[4-(ethylcarbamoylamino)cyclohexyl]carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 59418797 |
| Molecular Formula | C14H27N5O3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | N-[2-[[4-(ethylcarbamoylamino)cyclohexyl]carbamoylamino]ethyl]acetamide |
| SMILES | CCNC(=O)NC1CCC(NC(=O)NCCNC(C)=O)CC1 |
| InChI | InChI=1S/C14H27N5O3/c1-3-15-13(21)18-11-4-6-12(7-5-11)19-14(22)17-9-8-16-10(2)20/h11-12H,3-9H2,1-2H3,(H,16,20)(H2,15,18,21)(H2,17,19,22) |
| InChIKey | PQCDPEYAXPNRAX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|