C14H24N2O3 — CID 97416620
[4-(ethylcarbamoylamino)cyclohexyl] (Z)-2-methylbut-2-enoate (PubChem CID 97416620) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is [4-(ethylcarbamoylamino)cyclohexyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [4-(ethylcarbamoylamino)cyclohexyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 97416620 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [4-(ethylcarbamoylamino)cyclohexyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC1CCC(NC(=O)NCC)CC1 |
| InChI | InChI=1S/C14H24N2O3/c1-4-10(3)13(17)19-12-8-6-11(7-9-12)16-14(18)15-5-2/h4,11-12H,5-9H2,1-3H3,(H2,15,16,18)/b10-4- |
| InChIKey | ZNGOTUQKWBGYEO-WMZJFQQLSA-N |
| XLogP | 2.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|