C19H23N3O3 — CID 60584507
[4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(3-cyanophenyl)prop-2-enoate (PubChem CID 60584507) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(3-cyanophenyl)prop-2-enoate.
| Compound Name | [4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(3-cyanophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 60584507 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(3-cyanophenyl)prop-2-enoate |
| SMILES | CCNC(=O)NC1CCC(OC(=O)/C=C/c2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C19H23N3O3/c1-2-21-19(24)22-16-7-9-17(10-8-16)25-18(23)11-6-14-4-3-5-15(12-14)13-20/h3-6,11-12,16-17H,2,7-10H2,1H3,(H2,21,22,24)/b11-6+ |
| InChIKey | SAUXPJDXZQJHCC-IZZDOVSWSA-N |
| XLogP | 2.74 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|