C18H22N2O — CID 78864161
(E)-3-(3-cyanophenyl)-N-(2,6-dimethylcyclohexyl)prop-2-enamide (PubChem CID 78864161) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (E)-3-(3-cyanophenyl)-N-(2,6-dimethylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-(3-cyanophenyl)-N-(2,6-dimethylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 78864161 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (E)-3-(3-cyanophenyl)-N-(2,6-dimethylcyclohexyl)prop-2-enamide |
| SMILES | CC1CCCC(C)C1NC(=O)/C=C/c1cccc(C#N)c1 |
| InChI | InChI=1S/C18H22N2O/c1-13-5-3-6-14(2)18(13)20-17(21)10-9-15-7-4-8-16(11-15)12-19/h4,7-11,13-14,18H,3,5-6H2,1-2H3,(H,20,21)/b10-9+ |
| InChIKey | RUYYWTIXDILINU-MDZDMXLPSA-N |
| XLogP | 3.51 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|