C15H18N2O2 — CID 115884334
(E)-3-(3-cyanophenyl)-N-(3-hydroxy-2-methylbutan-2-yl)prop-2-enamide (PubChem CID 115884334) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (E)-3-(3-cyanophenyl)-N-(3-hydroxy-2-methylbutan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-cyanophenyl)-N-(3-hydroxy-2-methylbutan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 115884334 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (E)-3-(3-cyanophenyl)-N-(3-hydroxy-2-methylbutan-2-yl)prop-2-enamide |
| SMILES | CC(O)C(C)(C)NC(=O)/C=C/c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H18N2O2/c1-11(18)15(2,3)17-14(19)8-7-12-5-4-6-13(9-12)10-16/h4-9,11,18H,1-3H3,(H,17,19)/b8-7+ |
| InChIKey | JWTCCORQCBJRTP-BQYQJAHWSA-N |
| XLogP | 1.85 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|