C16H18N2O3 — CID 43469811
2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]hexanoic acid (PubChem CID 43469811) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]hexanoic acid.
| Compound Name | 2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 43469811 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)/C=C/c1cccc(C#N)c1)C(=O)O |
| InChI | InChI=1S/C16H18N2O3/c1-2-3-7-14(16(20)21)18-15(19)9-8-12-5-4-6-13(10-12)11-17/h4-6,8-10,14H,2-3,7H2,1H3,(H,18,19)(H,20,21)/b9-8+ |
| InChIKey | SNEMCGLUFHBTOW-CMDGGOBGSA-N |
| XLogP | 2.33 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|